C7H7Ag — CID 177393925
silver 5-methylhexa-1,3-diyne (PubChem CID 177393925) has the molecular formula C7H7Ag and a molecular weight of 199.00 g/mol. Its IUPAC name is silver 5-methylhexa-1,3-diyne.
| Compound Name | silver 5-methylhexa-1,3-diyne |
|---|---|
| PubChem CID | 177393925 |
| Molecular Formula | C7H7Ag |
| Molecular Weight | 199.00 g/mol |
| Exact Mass | 197.96 |
| IUPAC Name | silver 5-methylhexa-1,3-diyne |
| SMILES | [Ag+].[C-]#CC#CC(C)C |
| InChI | InChI=1S/C7H7.Ag/c1-4-5-6-7(2)3;/h7H,2-3H3;/q-1;+1 |
| InChIKey | MYYLGGIBAYFJOC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.00 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|