About 5-fluoro-2,6-dimethylhept-3-yne;methane
5-fluoro-2,6-dimethylhept-3-yne;methane (PubChem CID 161269298) has the molecular formula C10H19F
and a molecular weight of 158.26 g/mol. Its IUPAC name is 5-fluoro-2,6-dimethylhept-3-yne;methane.
Molecular Properties
| Compound Name | 5-fluoro-2,6-dimethylhept-3-yne;methane |
| PubChem CID | 161269298 |
| Molecular Formula | C10H19F |
| Molecular Weight | 158.26 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | 5-fluoro-2,6-dimethylhept-3-yne;methane |
| SMILES | C.CC(C)C#CC(F)C(C)C |
| InChI | InChI=1S/C9H15F.CH4/c1-7(2)5-6-9(10)8(3)4;/h7-9H,1-4H3;1H4 |
| InChIKey | VDPGKFOBMWDJCG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2,6-dimethylhept-3-yne;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,6-dimethylhept-3-yne;methane?
The IUPAC name of 5-fluoro-2,6-dimethylhept-3-yne;methane (CID 161269298) is 5-fluoro-2,6-dimethylhept-3-yne;methane.
What is the SMILES notation for 5-fluoro-2,6-dimethylhept-3-yne;methane?
The canonical SMILES for 5-fluoro-2,6-dimethylhept-3-yne;methane is C.CC(C)C#CC(F)C(C)C.
What is the InChIKey of 5-fluoro-2,6-dimethylhept-3-yne;methane?
The InChIKey is VDPGKFOBMWDJCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F.CH4/c1-7(2)5-6-9(10)8(3)4;/h7-9H,1-4H3;1H4.
What are the key properties of 5-fluoro-2,6-dimethylhept-3-yne;methane?
5-fluoro-2,6-dimethylhept-3-yne;methane has a molecular weight of 158.26 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,6-dimethylhept-3-yne;methane is sourced from PubChem (CID 161269298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).