About lithium (3R)-3-chlorooct-1-yne
lithium (3R)-3-chlorooct-1-yne (PubChem CID 177494929) has the molecular formula C8H12ClLi
and a molecular weight of 150.58 g/mol. Its IUPAC name is lithium (3R)-3-chlorooct-1-yne.
Molecular Properties
| Compound Name | lithium (3R)-3-chlorooct-1-yne |
| PubChem CID | 177494929 |
| Molecular Formula | C8H12ClLi |
| Molecular Weight | 150.58 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | lithium (3R)-3-chlorooct-1-yne |
| SMILES | [C-]#C[C@H](Cl)CCCCC.[Li+] |
| InChI | InChI=1S/C8H12Cl.Li/c1-3-5-6-7-8(9)4-2;/h8H,3,5-7H2,1H3;/q-1;+1/t8-;/m0./s1 |
| InChIKey | BTEGHDSOAWKHSV-QRPNPIFTSA-N |
| XLogP | -0.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.58 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze lithium (3R)-3-chlorooct-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium (3R)-3-chlorooct-1-yne?
The IUPAC name of lithium (3R)-3-chlorooct-1-yne (CID 177494929) is lithium (3R)-3-chlorooct-1-yne.
What is the SMILES notation for lithium (3R)-3-chlorooct-1-yne?
The canonical SMILES for lithium (3R)-3-chlorooct-1-yne is [C-]#C[C@H](Cl)CCCCC.[Li+].
What is the InChIKey of lithium (3R)-3-chlorooct-1-yne?
The InChIKey is BTEGHDSOAWKHSV-QRPNPIFTSA-N. The full InChI is InChI=1S/C8H12Cl.Li/c1-3-5-6-7-8(9)4-2;/h8H,3,5-7H2,1H3;/q-1;+1/t8-;/m0./s1.
What are the key properties of lithium (3R)-3-chlorooct-1-yne?
lithium (3R)-3-chlorooct-1-yne has a molecular weight of 150.58 g/mol, XLogP of -0.23, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium (3R)-3-chlorooct-1-yne is sourced from PubChem (CID 177494929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).