About lithium 3-butoxyoct-1-yne
lithium 3-butoxyoct-1-yne (PubChem CID 88798955) has the molecular formula C12H21LiO
and a molecular weight of 188.24 g/mol. Its IUPAC name is lithium 3-butoxyoct-1-yne.
Molecular Properties
| Compound Name | lithium 3-butoxyoct-1-yne |
| PubChem CID | 88798955 |
| Molecular Formula | C12H21LiO |
| Molecular Weight | 188.24 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | lithium 3-butoxyoct-1-yne |
| SMILES | [C-]#CC(CCCCC)OCCCC.[Li+] |
| InChI | InChI=1S/C12H21O.Li/c1-4-7-9-10-12(6-3)13-11-8-5-2;/h12H,4-5,7-11H2,1-2H3;/q-1;+1 |
| InChIKey | HCZQBZAOTXKUBW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze lithium 3-butoxyoct-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 3-butoxyoct-1-yne?
The IUPAC name of lithium 3-butoxyoct-1-yne (CID 88798955) is lithium 3-butoxyoct-1-yne.
What is the SMILES notation for lithium 3-butoxyoct-1-yne?
The canonical SMILES for lithium 3-butoxyoct-1-yne is [C-]#CC(CCCCC)OCCCC.[Li+].
What is the InChIKey of lithium 3-butoxyoct-1-yne?
The InChIKey is HCZQBZAOTXKUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21O.Li/c1-4-7-9-10-12(6-3)13-11-8-5-2;/h12H,4-5,7-11H2,1-2H3;/q-1;+1.
What are the key properties of lithium 3-butoxyoct-1-yne?
lithium 3-butoxyoct-1-yne has a molecular weight of 188.24 g/mol, XLogP of 0.35, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 3-butoxyoct-1-yne is sourced from PubChem (CID 88798955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).