C6H8OS5 — CID 11010596
4-(2-hydroxyethylsulfanyl)-5-methylsulfanyl-1,3-dithiole-2-thione (PubChem CID 11010596) has the molecular formula C6H8OS5 and a molecular weight of 256.46 g/mol. Its IUPAC name is 4-(2-hydroxyethylsulfanyl)-5-methylsulfanyl-1,3-dithiole-2-thione.
| Compound Name | 4-(2-hydroxyethylsulfanyl)-5-methylsulfanyl-1,3-dithiole-2-thione |
|---|---|
| PubChem CID | 11010596 |
| Molecular Formula | C6H8OS5 |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 255.92 |
| IUPAC Name | 4-(2-hydroxyethylsulfanyl)-5-methylsulfanyl-1,3-dithiole-2-thione |
| SMILES | CSc1sc(=S)sc1SCCO |
| InChI | InChI=1S/C6H8OS5/c1-9-4-5(10-3-2-7)12-6(8)11-4/h7H,2-3H2,1H3 |
| InChIKey | KMPPTJVFOVUZMP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|