C19H23FN2O2 — CID 110128684
(4S,5S)-5-(4-fluorophenoxy)-1-[(6-methyl-3-pyridinyl)methyl]azepan-4-ol (PubChem CID 110128684) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is (4S,5S)-5-(4-fluorophenoxy)-1-[(6-methyl-3-pyridinyl)methyl]azepan-4-ol.
| Compound Name | (4S,5S)-5-(4-fluorophenoxy)-1-[(6-methyl-3-pyridinyl)methyl]azepan-4-ol |
|---|---|
| PubChem CID | 110128684 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (4S,5S)-5-(4-fluorophenoxy)-1-[(6-methyl-3-pyridinyl)methyl]azepan-4-ol |
| SMILES | Cc1ccc(CN2CC[C@H](Oc3ccc(F)cc3)[C@@H](O)CC2)cn1 |
| InChI | InChI=1S/C19H23FN2O2/c1-14-2-3-15(12-21-14)13-22-10-8-18(23)19(9-11-22)24-17-6-4-16(20)5-7-17/h2-7,12,18-19,23H,8-11,13H2,1H3/t18-,19-/m0/s1 |
| InChIKey | SYHWSBORMHWGSY-OALUTQOASA-N |
| XLogP | 2.93 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |