C13H10BClF4N4 — CID 11013369
5-chloro-1,3-diphenyltetrazol-1-ium tetrafluoroborate (PubChem CID 11013369) has the molecular formula C13H10BClF4N4 and a molecular weight of 344.51 g/mol. Its IUPAC name is 5-chloro-1,3-diphenyltetrazol-1-ium tetrafluoroborate.
| Compound Name | 5-chloro-1,3-diphenyltetrazol-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 11013369 |
| Molecular Formula | C13H10BClF4N4 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 5-chloro-1,3-diphenyltetrazol-1-ium tetrafluoroborate |
| SMILES | Clc1nn(-c2ccccc2)n[n+]1-c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C13H10ClN4.BF4/c14-13-15-18(12-9-5-2-6-10-12)16-17(13)11-7-3-1-4-8-11;2-1(3,4)5/h1-10H;/q+1;-1 |
| InChIKey | AHQBDLMPMYMBKF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|