C31H25N5P+ — CID 11801450
(1,3-diphenyltetrazol-1-ium-5-yl)imino-triphenyl-λ5-phosphane (PubChem CID 11801450) has the molecular formula C31H25N5P+ and a molecular weight of 498.55 g/mol. Its IUPAC name is (1,3-diphenyltetrazol-1-ium-5-yl)imino-triphenyl-λ5-phosphane.
| Compound Name | (1,3-diphenyltetrazol-1-ium-5-yl)imino-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 11801450 |
| Molecular Formula | C31H25N5P+ |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | (1,3-diphenyltetrazol-1-ium-5-yl)imino-triphenyl-λ5-phosphane |
| SMILES | c1ccc(-n2nc(N=P(c3ccccc3)(c3ccccc3)c3ccccc3)[n+](-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C31H25N5P/c1-6-16-26(17-7-1)35-31(32-36(34-35)27-18-8-2-9-19-27)33-37(28-20-10-3-11-21-28,29-22-12-4-13-23-29)30-24-14-5-15-25-30/h1-25H/q+1 |
| InChIKey | DDMLWGXKHFUTHG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|