C19H17N7O4 — CID 10993203
(Z)-2-[[(E)-N-(1,3-diphenyltetrazol-1-ium-5-yl)-C-methoxycarbonylcarbonimidoyl]diazenyl]-1-methoxyethenolate (PubChem CID 10993203) has the molecular formula C19H17N7O4 and a molecular weight of 407.39 g/mol. Its IUPAC name is (Z)-2-[[(E)-N-(1,3-diphenyltetrazol-1-ium-5-yl)-C-methoxycarbonylcarbonimidoyl]diazenyl]-1-methoxyethenolate.
| Compound Name | (Z)-2-[[(E)-N-(1,3-diphenyltetrazol-1-ium-5-yl)-C-methoxycarbonylcarbonimidoyl]diazenyl]-1-methoxyethenolate |
|---|---|
| PubChem CID | 10993203 |
| Molecular Formula | C19H17N7O4 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (Z)-2-[[(E)-N-(1,3-diphenyltetrazol-1-ium-5-yl)-C-methoxycarbonylcarbonimidoyl]diazenyl]-1-methoxyethenolate |
| SMILES | COC(=O)C(/N=N/C=C(/[O-])OC)=N\c1nn(-c2ccccc2)n[n+]1-c1ccccc1 |
| InChI | InChI=1S/C19H17N7O4/c1-29-16(27)13-20-22-17(18(28)30-2)21-19-23-26(15-11-7-4-8-12-15)24-25(19)14-9-5-3-6-10-14/h3-13H,1-2H3 |
| InChIKey | XRANCVJEYHOIMF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 130.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|