C27H24N10+2 — CID 10769443
1,2-bis(1,3-diphenyltetrazol-1-ium-5-yl)-1-methylhydrazine (PubChem CID 10769443) has the molecular formula C27H24N10+2 and a molecular weight of 488.56 g/mol. Its IUPAC name is 1,2-bis(1,3-diphenyltetrazol-1-ium-5-yl)-1-methylhydrazine.
| Compound Name | 1,2-bis(1,3-diphenyltetrazol-1-ium-5-yl)-1-methylhydrazine |
|---|---|
| PubChem CID | 10769443 |
| Molecular Formula | C27H24N10+2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 1,2-bis(1,3-diphenyltetrazol-1-ium-5-yl)-1-methylhydrazine |
| SMILES | CN(Nc1nn(-c2ccccc2)n[n+]1-c1ccccc1)c1nn(-c2ccccc2)n[n+]1-c1ccccc1 |
| InChI | InChI=1S/C27H24N10/c1-33(27-30-37(25-20-12-5-13-21-25)32-35(27)23-16-8-3-9-17-23)28-26-29-36(24-18-10-4-11-19-24)31-34(26)22-14-6-2-7-15-22/h2-21H,1H3,(H,28,29,31)/q+2 |
| InChIKey | LNZMKXCNEUOQDO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|