C20H18N6 — CID 10545250
N-[(E)-(1,3-diphenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-ylidene)amino]-N-methylaniline (PubChem CID 10545250) has the molecular formula C20H18N6 and a molecular weight of 342.41 g/mol. Its IUPAC name is N-[(E)-(1,3-diphenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-ylidene)amino]-N-methylaniline.
| Compound Name | N-[(E)-(1,3-diphenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-ylidene)amino]-N-methylaniline |
|---|---|
| PubChem CID | 10545250 |
| Molecular Formula | C20H18N6 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[(E)-(1,3-diphenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-ylidene)amino]-N-methylaniline |
| SMILES | CN(/N=c1\[n-][n+](-c2ccccc2)nn1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18N6/c1-24(17-11-5-2-6-12-17)21-20-22-26(19-15-9-4-10-16-19)23-25(20)18-13-7-3-8-14-18/h2-16H,1H3/b21-20+ |
| InChIKey | KIKCMPNGZNIDMX-QZQOTICOSA-N |
| XLogP | 2.06 |
| TPSA | 51.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|