C17H19N5 — CID 177426537
N-butyl-1,3-diphenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-imine (PubChem CID 177426537) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-butyl-1,3-diphenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-imine.
| Compound Name | N-butyl-1,3-diphenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-imine |
|---|---|
| PubChem CID | 177426537 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-butyl-1,3-diphenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-imine |
| SMILES | CCCC/N=c1\[n-][n+](-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C17H19N5/c1-2-3-14-18-17-19-22(16-12-8-5-9-13-16)20-21(17)15-10-6-4-7-11-15/h4-13H,2-3,14H2,1H3/b18-17+ |
| InChIKey | KOAJFNPLMIFKDA-ISLYRVAYSA-N |
| XLogP | 1.81 |
| TPSA | 48.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|