C17H18BrN5 — CID 177483918
1-(2-bromophenyl)-N-butyl-3-phenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-imine (PubChem CID 177483918) has the molecular formula C17H18BrN5 and a molecular weight of 372.27 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-butyl-3-phenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-imine.
| Compound Name | 1-(2-bromophenyl)-N-butyl-3-phenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-imine |
|---|---|
| PubChem CID | 177483918 |
| Molecular Formula | C17H18BrN5 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 1-(2-bromophenyl)-N-butyl-3-phenyl-1,2-diaza-3-azonia-4-azanidacyclopent-2-en-5-imine |
| SMILES | CCCC/N=c1\[n-][n+](-c2ccccc2)nn1-c1ccccc1Br |
| InChI | InChI=1S/C17H18BrN5/c1-2-3-13-19-17-20-23(14-9-5-4-6-10-14)21-22(17)16-12-8-7-11-15(16)18/h4-12H,2-3,13H2,1H3/b19-17+ |
| InChIKey | CWNYNLPRCNRYLF-HTXNQAPBSA-N |
| XLogP | 2.57 |
| TPSA | 48.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|