C16H16N4O — CID 10731440
3-phenyl-1-(2,4,6-trimethylphenyl)tetrazol-1-ium-5-olate (PubChem CID 10731440) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-phenyl-1-(2,4,6-trimethylphenyl)tetrazol-1-ium-5-olate.
| Compound Name | 3-phenyl-1-(2,4,6-trimethylphenyl)tetrazol-1-ium-5-olate |
|---|---|
| PubChem CID | 10731440 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-phenyl-1-(2,4,6-trimethylphenyl)tetrazol-1-ium-5-olate |
| SMILES | Cc1cc(C)c(-[n+]2nn(-c3ccccc3)nc2[O-])c(C)c1 |
| InChI | InChI=1S/C16H16N4O/c1-11-9-12(2)15(13(3)10-11)19-16(21)17-20(18-19)14-7-5-4-6-8-14/h4-10H,1-3H3 |
| InChIKey | PNWBCLCXSSWGLI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|