C42H49NSi2 — CID 15632733
1-phenyl-2,2,3,3-tetrakis(2,4,6-trimethylphenyl)azadisiliridine (PubChem CID 15632733) has the molecular formula C42H49NSi2 and a molecular weight of 624.03 g/mol. Its IUPAC name is 1-phenyl-2,2,3,3-tetrakis(2,4,6-trimethylphenyl)azadisiliridine.
| Compound Name | 1-phenyl-2,2,3,3-tetrakis(2,4,6-trimethylphenyl)azadisiliridine |
|---|---|
| PubChem CID | 15632733 |
| Molecular Formula | C42H49NSi2 |
| Molecular Weight | 624.03 g/mol |
| Exact Mass | 623.34 |
| IUPAC Name | 1-phenyl-2,2,3,3-tetrakis(2,4,6-trimethylphenyl)azadisiliridine |
| SMILES | Cc1cc(C)c([Si]2(c3c(C)cc(C)cc3C)N(c3ccccc3)[Si]2(c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C42H49NSi2/c1-26-18-30(5)39(31(6)19-26)44(40-32(7)20-27(2)21-33(40)8)43(38-16-14-13-15-17-38)45(44,41-34(9)22-28(3)23-35(41)10)42-36(11)24-29(4)25-37(42)12/h13-25H,1-12H3 |
| InChIKey | OIVIMNOYOSTORZ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.03 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|