C47H58Si3 — CID 13057955
trimethyl-[phenyl-[1,1,2,2-tetrakis(2,4,6-trimethylphenyl)disiliran-3-ylidene]methyl]silane (PubChem CID 13057955) has the molecular formula C47H58Si3 and a molecular weight of 707.24 g/mol. Its IUPAC name is trimethyl-[phenyl-[1,1,2,2-tetrakis(2,4,6-trimethylphenyl)disiliran-3-ylidene]methyl]silane.
| Compound Name | trimethyl-[phenyl-[1,1,2,2-tetrakis(2,4,6-trimethylphenyl)disiliran-3-ylidene]methyl]silane |
|---|---|
| PubChem CID | 13057955 |
| Molecular Formula | C47H58Si3 |
| Molecular Weight | 707.24 g/mol |
| Exact Mass | 706.38 |
| IUPAC Name | trimethyl-[phenyl-[1,1,2,2-tetrakis(2,4,6-trimethylphenyl)disiliran-3-ylidene]methyl]silane |
| SMILES | Cc1cc(C)c([Si]2(c3c(C)cc(C)cc3C)C(=C(c3ccccc3)[Si](C)(C)C)[Si]2(c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C47H58Si3/c1-29-21-33(5)42(34(6)22-29)49(43-35(7)23-30(2)24-36(43)8)47(46(48(13,14)15)41-19-17-16-18-20-41)50(49,44-37(9)25-31(3)26-38(44)10)45-39(11)27-32(4)28-40(45)12/h16-28H,1-15H3 |
| InChIKey | IBHWRFYZEYFTHU-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.24 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|