C24H32OSi — CID 154824599
(E)-1-phenyl-3-(2,4,6-trimethylphenyl)-2-trimethylsilylhex-2-en-1-one (PubChem CID 154824599) has the molecular formula C24H32OSi and a molecular weight of 364.61 g/mol. Its IUPAC name is (E)-1-phenyl-3-(2,4,6-trimethylphenyl)-2-trimethylsilylhex-2-en-1-one.
| Compound Name | (E)-1-phenyl-3-(2,4,6-trimethylphenyl)-2-trimethylsilylhex-2-en-1-one |
|---|---|
| PubChem CID | 154824599 |
| Molecular Formula | C24H32OSi |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (E)-1-phenyl-3-(2,4,6-trimethylphenyl)-2-trimethylsilylhex-2-en-1-one |
| SMILES | CCC/C(=C(/C(=O)c1ccccc1)[Si](C)(C)C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H32OSi/c1-8-12-21(22-18(3)15-17(2)16-19(22)4)24(26(5,6)7)23(25)20-13-10-9-11-14-20/h9-11,13-16H,8,12H2,1-7H3/b24-21+ |
| InChIKey | RKFPQFPZDGJHBV-DARPEHSRSA-N |
| XLogP | 6.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|