C22H21O3P — CID 57114457
(3,3-diphenyl-1,2,3λ5-dioxaphosphiran-3-yl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 57114457) has the molecular formula C22H21O3P and a molecular weight of 364.38 g/mol. Its IUPAC name is (3,3-diphenyl-1,2,3λ5-dioxaphosphiran-3-yl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (3,3-diphenyl-1,2,3λ5-dioxaphosphiran-3-yl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 57114457 |
| Molecular Formula | C22H21O3P |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (3,3-diphenyl-1,2,3λ5-dioxaphosphiran-3-yl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P2(c3ccccc3)(c3ccccc3)OO2)c(C)c1 |
| InChI | InChI=1S/C22H21O3P/c1-16-14-17(2)21(18(3)15-16)22(23)26(24-25-26,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15H,1-3H3 |
| InChIKey | DORKDWTXIRNUOX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|