C25H32N2O3 — CID 110134038
N-[(2R,4R,4aS,8aR)-2-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]benzamide (PubChem CID 110134038) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is N-[(2R,4R,4aS,8aR)-2-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]benzamide.
| Compound Name | N-[(2R,4R,4aS,8aR)-2-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]benzamide |
|---|---|
| PubChem CID | 110134038 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N-[(2R,4R,4aS,8aR)-2-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]benzamide |
| SMILES | CN(C)Cc1cc([C@H]2C[C@@H](NC(=O)c3ccccc3)[C@@H]3CCCC[C@H]3O2)ccc1O |
| InChI | InChI=1S/C25H32N2O3/c1-27(2)16-19-14-18(12-13-22(19)28)24-15-21(20-10-6-7-11-23(20)30-24)26-25(29)17-8-4-3-5-9-17/h3-5,8-9,12-14,20-21,23-24,28H,6-7,10-11,15-16H2,1-2H3,(H,26,29)/t20-,21+,23+,24+/m0/s1 |
| InChIKey | BWZCEGMPTQYZCN-XWVZOOPGSA-N |
| XLogP | 4.27 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|