C24H29NO4 — CID 110152953
N-[(2R,4R,4aS,8aR)-2-[3-(2-hydroxyethoxy)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]benzamide (PubChem CID 110152953) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[(2R,4R,4aS,8aR)-2-[3-(2-hydroxyethoxy)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]benzamide.
| Compound Name | N-[(2R,4R,4aS,8aR)-2-[3-(2-hydroxyethoxy)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]benzamide |
|---|---|
| PubChem CID | 110152953 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | N-[(2R,4R,4aS,8aR)-2-[3-(2-hydroxyethoxy)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]benzamide |
| SMILES | O=C(N[C@@H]1C[C@H](c2cccc(OCCO)c2)O[C@@H]2CCCC[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C24H29NO4/c26-13-14-28-19-10-6-9-18(15-19)23-16-21(20-11-4-5-12-22(20)29-23)25-24(27)17-7-2-1-3-8-17/h1-3,6-10,15,20-23,26H,4-5,11-14,16H2,(H,25,27)/t20-,21+,22+,23+/m0/s1 |
| InChIKey | ACQLFJAUSMKFSH-WBADGQHESA-N |
| XLogP | 3.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |