C22H27NO6 — CID 123626877
N-[3-[3-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]phenoxy]propyl]benzamide (PubChem CID 123626877) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[3-[3-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]phenoxy]propyl]benzamide.
| Compound Name | N-[3-[3-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]phenoxy]propyl]benzamide |
|---|---|
| PubChem CID | 123626877 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[3-[3-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]phenoxy]propyl]benzamide |
| SMILES | O=C(NCCCOc1cccc(C2OC(CO)CC(O)C2O)c1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO6/c24-14-18-13-19(25)20(26)21(29-18)16-8-4-9-17(12-16)28-11-5-10-23-22(27)15-6-2-1-3-7-15/h1-4,6-9,12,18-21,24-26H,5,10-11,13-14H2,(H,23,27) |
| InChIKey | WNTBKUZGVFABGT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|