C24H30N2O3 — CID 110136006
(3R,3aS,9aR)-1-[(2,3-dimethoxyphenyl)methyl]-3-phenyl-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one (PubChem CID 110136006) has the molecular formula C24H30N2O3 and a molecular weight of 394.51 g/mol. Its IUPAC name is (3R,3aS,9aR)-1-[(2,3-dimethoxyphenyl)methyl]-3-phenyl-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one.
| Compound Name | (3R,3aS,9aR)-1-[(2,3-dimethoxyphenyl)methyl]-3-phenyl-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one |
|---|---|
| PubChem CID | 110136006 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (3R,3aS,9aR)-1-[(2,3-dimethoxyphenyl)methyl]-3-phenyl-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one |
| SMILES | COc1cccc(CN2C[C@@H](c3ccccc3)[C@@H]3NC(=O)CCCC[C@H]32)c1OC |
| InChI | InChI=1S/C24H30N2O3/c1-28-21-13-8-11-18(24(21)29-2)15-26-16-19(17-9-4-3-5-10-17)23-20(26)12-6-7-14-22(27)25-23/h3-5,8-11,13,19-20,23H,6-7,12,14-16H2,1-2H3,(H,25,27)/t19-,20+,23-/m0/s1 |
| InChIKey | HKRJZBXHVNTADT-MZKRTTBSSA-N |
| XLogP | 3.73 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |