C16H23N3O3S — CID 110136957
N-[(3aS,7aS)-5-(4-methylphenyl)sulfonyl-2,3,3a,4,6,7-hexahydro-1H-pyrrolo[3,4-c]pyridin-7a-yl]acetamide (PubChem CID 110136957) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is N-[(3aS,7aS)-5-(4-methylphenyl)sulfonyl-2,3,3a,4,6,7-hexahydro-1H-pyrrolo[3,4-c]pyridin-7a-yl]acetamide.
| Compound Name | N-[(3aS,7aS)-5-(4-methylphenyl)sulfonyl-2,3,3a,4,6,7-hexahydro-1H-pyrrolo[3,4-c]pyridin-7a-yl]acetamide |
|---|---|
| PubChem CID | 110136957 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(3aS,7aS)-5-(4-methylphenyl)sulfonyl-2,3,3a,4,6,7-hexahydro-1H-pyrrolo[3,4-c]pyridin-7a-yl]acetamide |
| SMILES | CC(=O)N[C@@]12CCN(S(=O)(=O)c3ccc(C)cc3)C[C@@H]1CNC2 |
| InChI | InChI=1S/C16H23N3O3S/c1-12-3-5-15(6-4-12)23(21,22)19-8-7-16(18-13(2)20)11-17-9-14(16)10-19/h3-6,14,17H,7-11H2,1-2H3,(H,18,20)/t14-,16+/m0/s1 |
| InChIKey | LAXYZBNUERMXKD-GOEBONIOSA-N |
| XLogP | 0.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |