C12H14N2O3S — CID 110139857
(4aS,7aS)-6-(2-thiophen-2-ylacetyl)-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]oxazin-3-one (PubChem CID 110139857) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is (4aS,7aS)-6-(2-thiophen-2-ylacetyl)-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aS,7aS)-6-(2-thiophen-2-ylacetyl)-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 110139857 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (4aS,7aS)-6-(2-thiophen-2-ylacetyl)-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@H]2CN(C(=O)Cc3cccs3)C[C@@H]2N1 |
| InChI | InChI=1S/C12H14N2O3S/c15-11-7-17-10-6-14(5-9(10)13-11)12(16)4-8-2-1-3-18-8/h1-3,9-10H,4-7H2,(H,13,15)/t9-,10-/m0/s1 |
| InChIKey | AHBWVAUKPGITCY-UWVGGRQHSA-N |
| XLogP | 0.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |