C12H12N2O3S2 — CID 121155018
3-[1-(2-thiophen-2-ylacetyl)azetidin-3-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 121155018) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-[1-(2-thiophen-2-ylacetyl)azetidin-3-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[1-(2-thiophen-2-ylacetyl)azetidin-3-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121155018 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 3-[1-(2-thiophen-2-ylacetyl)azetidin-3-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(Cc1cccs1)N1CC(N2C(=O)CSC2=O)C1 |
| InChI | InChI=1S/C12H12N2O3S2/c15-10(4-9-2-1-3-18-9)13-5-8(6-13)14-11(16)7-19-12(14)17/h1-3,8H,4-7H2 |
| InChIKey | PELZSNMTQZAXSN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|