C13H17N3O7 — CID 110145376
4-[[(1R,2S,3R,4S)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]amino]-4-oxobutanoic acid (PubChem CID 110145376) has the molecular formula C13H17N3O7 and a molecular weight of 327.29 g/mol. Its IUPAC name is 4-[[(1R,2S,3R,4S)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(1R,2S,3R,4S)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 110145376 |
| Molecular Formula | C13H17N3O7 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-[[(1R,2S,3R,4S)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N[C@@H]1C[C@H](n2ccc(=O)[nH]c2=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H17N3O7/c17-8(1-2-10(19)20)14-6-5-7(12(22)11(6)21)16-4-3-9(18)15-13(16)23/h3-4,6-7,11-12,21-22H,1-2,5H2,(H,14,17)(H,19,20)(H,15,18,23)/t6-,7+,11+,12-/m1/s1 |
| InChIKey | KGIFZIUWYVCOCS-RQJHRRTKSA-N |
| XLogP | -2.45 |
| TPSA | 161.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |