C15H18N8O — CID 110146308
(3R,4R)-4-(6-aminopurin-9-yl)-3-methyl-1-pyrazin-2-ylpiperidin-3-ol (PubChem CID 110146308) has the molecular formula C15H18N8O and a molecular weight of 326.36 g/mol. Its IUPAC name is (3R,4R)-4-(6-aminopurin-9-yl)-3-methyl-1-pyrazin-2-ylpiperidin-3-ol.
| Compound Name | (3R,4R)-4-(6-aminopurin-9-yl)-3-methyl-1-pyrazin-2-ylpiperidin-3-ol |
|---|---|
| PubChem CID | 110146308 |
| Molecular Formula | C15H18N8O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (3R,4R)-4-(6-aminopurin-9-yl)-3-methyl-1-pyrazin-2-ylpiperidin-3-ol |
| SMILES | C[C@@]1(O)CN(c2cnccn2)CC[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H18N8O/c1-15(24)7-22(11-6-17-3-4-18-11)5-2-10(15)23-9-21-12-13(16)19-8-20-14(12)23/h3-4,6,8-10,24H,2,5,7H2,1H3,(H2,16,19,20)/t10-,15-/m1/s1 |
| InChIKey | VBXKKNKHRLDRPS-MEBBXXQBSA-N |
| XLogP | 0.40 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |