C25H32O8 — CID 11015987
(1R,3S)-1-[(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-3-[(2S,4S)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]propane-1,3-diol (PubChem CID 11015987) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is (1R,3S)-1-[(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-3-[(2S,4S)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]propane-1,3-diol.
| Compound Name | (1R,3S)-1-[(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-3-[(2S,4S)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 11015987 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (1R,3S)-1-[(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-3-[(2S,4S)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]propane-1,3-diol |
| SMILES | COc1ccc([C@@H]2OCC[C@H]([C@H](O)C[C@H](O)[C@@H]3CCO[C@H](c4ccc(OC)cc4)O3)O2)cc1 |
| InChI | InChI=1S/C25H32O8/c1-28-18-7-3-16(4-8-18)24-30-13-11-22(32-24)20(26)15-21(27)23-12-14-31-25(33-23)17-5-9-19(29-2)10-6-17/h3-10,20-27H,11-15H2,1-2H3/t20-,21+,22-,23+,24-,25+ |
| InChIKey | UTPLHRZUFFGPSM-ZWZZYCPGSA-N |
| XLogP | 3.12 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |