About (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane
(4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane (PubChem CID 117070787) has the molecular formula C18H26O3S2
and a molecular weight of 354.54 g/mol. Its IUPAC name is (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane.
Molecular Properties
| Compound Name | (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane |
| PubChem CID | 117070787 |
| Molecular Formula | C18H26O3S2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane |
| SMILES | COc1ccc(C2OCC[C@@H](C[C@@H](C)C3SCCCS3)O2)cc1 |
| InChI | InChI=1S/C18H26O3S2/c1-13(18-22-10-3-11-23-18)12-16-8-9-20-17(21-16)14-4-6-15(19-2)7-5-14/h4-7,13,16-18H,3,8-12H2,1-2H3/t13-,16+,17?/m1/s1 |
| InChIKey | XYTNTSSIIVZIEO-WBTZKQGOSA-N |
| XLogP | 4.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane?
The IUPAC name of (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane (CID 117070787) is (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane.
What is the SMILES notation for (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane?
The canonical SMILES for (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane is COc1ccc(C2OCC[C@@H](C[C@@H](C)C3SCCCS3)O2)cc1.
What is the InChIKey of (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane?
The InChIKey is XYTNTSSIIVZIEO-WBTZKQGOSA-N. The full InChI is InChI=1S/C18H26O3S2/c1-13(18-22-10-3-11-23-18)12-16-8-9-20-17(21-16)14-4-6-15(19-2)7-5-14/h4-7,13,16-18H,3,8-12H2,1-2H3/t13-,16+,17?/m1/s1.
What are the key properties of (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane?
(4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane has a molecular weight of 354.54 g/mol, XLogP of 4.72, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[(2R)-2-(1,3-dithian-2-yl)propyl]-2-(4-methoxyphenyl)-1,3-dioxane is sourced from PubChem (CID 117070787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).