C23H28O6 — CID 56647530
[(2S,3R)-3-[(S)-(4-methoxyphenyl)methoxy-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]methyl]-3-methyloxiran-2-yl]methanol (PubChem CID 56647530) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is [(2S,3R)-3-[(S)-(4-methoxyphenyl)methoxy-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]methyl]-3-methyloxiran-2-yl]methanol.
| Compound Name | [(2S,3R)-3-[(S)-(4-methoxyphenyl)methoxy-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]methyl]-3-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 56647530 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [(2S,3R)-3-[(S)-(4-methoxyphenyl)methoxy-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]methyl]-3-methyloxiran-2-yl]methanol |
| SMILES | COc1ccc(CO[C@@H]([C@@H]2CCO[C@H](c3ccccc3)O2)[C@]2(C)O[C@H]2CO)cc1 |
| InChI | InChI=1S/C23H28O6/c1-23(20(14-24)29-23)21(27-15-16-8-10-18(25-2)11-9-16)19-12-13-26-22(28-19)17-6-4-3-5-7-17/h3-11,19-22,24H,12-15H2,1-2H3/t19-,20-,21-,22-,23+/m0/s1 |
| InChIKey | CIMGQWBINHAAIT-XZCBWCRCSA-N |
| XLogP | 3.23 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|