C17H10F13NO2 — CID 11016646
1-[3-phenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,2-oxazol-4-yl]ethanol (PubChem CID 11016646) has the molecular formula C17H10F13NO2 and a molecular weight of 507.25 g/mol. Its IUPAC name is 1-[3-phenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,2-oxazol-4-yl]ethanol.
| Compound Name | 1-[3-phenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,2-oxazol-4-yl]ethanol |
|---|---|
| PubChem CID | 11016646 |
| Molecular Formula | C17H10F13NO2 |
| Molecular Weight | 507.25 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | 1-[3-phenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,2-oxazol-4-yl]ethanol |
| SMILES | CC(O)c1c(-c2ccccc2)noc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H10F13NO2/c1-7(32)9-10(8-5-3-2-4-6-8)31-33-11(9)12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h2-7,32H,1H3 |
| InChIKey | MZVCCEMGFOPRSQ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.25 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|