C24H15F7NO4P — CID 10053142
4-diphenoxyphosphoryl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1,2-oxazole (PubChem CID 10053142) has the molecular formula C24H15F7NO4P and a molecular weight of 545.35 g/mol. Its IUPAC name is 4-diphenoxyphosphoryl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1,2-oxazole.
| Compound Name | 4-diphenoxyphosphoryl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 10053142 |
| Molecular Formula | C24H15F7NO4P |
| Molecular Weight | 545.35 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | 4-diphenoxyphosphoryl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1,2-oxazole |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)c1c(-c2ccccc2)noc1C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H15F7NO4P/c25-22(26,23(27,28)24(29,30)31)21-20(19(32-34-21)16-10-4-1-5-11-16)37(33,35-17-12-6-2-7-13-17)36-18-14-8-3-9-15-18/h1-15H |
| InChIKey | LCHLACHQAUUZPO-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.35 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|