C27H33ClN2O3S — CID 110171562
2-(4-chloro-2-methylphenoxy)-N-[4-(3-ethyl-4-heptoxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 110171562) has the molecular formula C27H33ClN2O3S and a molecular weight of 501.09 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-[4-(3-ethyl-4-heptoxyphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-[4-(3-ethyl-4-heptoxyphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110171562 |
| Molecular Formula | C27H33ClN2O3S |
| Molecular Weight | 501.09 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-[4-(3-ethyl-4-heptoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCCCCCOc1ccc(-c2csc(NC(=O)COc3ccc(Cl)cc3C)n2)cc1CC |
| InChI | InChI=1S/C27H33ClN2O3S/c1-4-6-7-8-9-14-32-25-12-10-21(16-20(25)5-2)23-18-34-27(29-23)30-26(31)17-33-24-13-11-22(28)15-19(24)3/h10-13,15-16,18H,4-9,14,17H2,1-3H3,(H,29,30,31) |
| InChIKey | PXHZHLIYYJRXIW-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.09 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|