methyl 8-methyl-2,4-dioxopteridine-6-carboxylate

C9H8N4O4 — CID 110171852

IUPACmethyl 8-methyl-2,4-dioxopteridine-6-carboxylate
SMILESCOC(=O)c1cn(C)c2nc(=O)[nH]c(=O)c-2n1
InChIInChI=1S/C9H8N4O4/c1-13-3-4(8(15)17-2)10-5-6(13)11-9(16)12-7(5)14/h3H,1-2H3,(H,12,14,16)
InChIKeyOCTSUUFPRWCDRZ-UHFFFAOYSA-N
MW236.19 g/mol
LogP-1.25
Rot. Bonds1

About methyl 8-methyl-2,4-dioxopteridine-6-carboxylate

methyl 8-methyl-2,4-dioxopteridine-6-carboxylate (PubChem CID 110171852) has the molecular formula C9H8N4O4 and a molecular weight of 236.19 g/mol. Its IUPAC name is methyl 8-methyl-2,4-dioxopteridine-6-carboxylate.

Molecular Properties

Compound Namemethyl 8-methyl-2,4-dioxopteridine-6-carboxylate
PubChem CID110171852
Molecular FormulaC9H8N4O4
Molecular Weight236.19 g/mol
Exact Mass236.05
IUPAC Namemethyl 8-methyl-2,4-dioxopteridine-6-carboxylate
SMILESCOC(=O)c1cn(C)c2nc(=O)[nH]c(=O)c-2n1
InChIInChI=1S/C9H8N4O4/c1-13-3-4(8(15)17-2)10-5-6(13)11-9(16)12-7(5)14/h3H,1-2H3,(H,12,14,16)
InChIKeyOCTSUUFPRWCDRZ-UHFFFAOYSA-N
XLogP-1.25
TPSA106.94 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.19
LogP ≤ 5-1.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze methyl 8-methyl-2,4-dioxopteridine-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 8-methyl-2,4-dioxopteridine-6-carboxylate?
The IUPAC name of methyl 8-methyl-2,4-dioxopteridine-6-carboxylate (CID 110171852) is methyl 8-methyl-2,4-dioxopteridine-6-carboxylate.
What is the SMILES notation for methyl 8-methyl-2,4-dioxopteridine-6-carboxylate?
The canonical SMILES for methyl 8-methyl-2,4-dioxopteridine-6-carboxylate is COC(=O)c1cn(C)c2nc(=O)[nH]c(=O)c-2n1.
What is the InChIKey of methyl 8-methyl-2,4-dioxopteridine-6-carboxylate?
The InChIKey is OCTSUUFPRWCDRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O4/c1-13-3-4(8(15)17-2)10-5-6(13)11-9(16)12-7(5)14/h3H,1-2H3,(H,12,14,16).
What are the key properties of methyl 8-methyl-2,4-dioxopteridine-6-carboxylate?
methyl 8-methyl-2,4-dioxopteridine-6-carboxylate has a molecular weight of 236.19 g/mol, XLogP of -1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-methyl-2,4-dioxopteridine-6-carboxylate is sourced from PubChem (CID 110171852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).