C9H8N4O4 — CID 110171852
methyl 8-methyl-2,4-dioxopteridine-6-carboxylate (PubChem CID 110171852) has the molecular formula C9H8N4O4 and a molecular weight of 236.19 g/mol. Its IUPAC name is methyl 8-methyl-2,4-dioxopteridine-6-carboxylate.
| Compound Name | methyl 8-methyl-2,4-dioxopteridine-6-carboxylate |
|---|---|
| PubChem CID | 110171852 |
| Molecular Formula | C9H8N4O4 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | methyl 8-methyl-2,4-dioxopteridine-6-carboxylate |
| SMILES | COC(=O)c1cn(C)c2nc(=O)[nH]c(=O)c-2n1 |
| InChI | InChI=1S/C9H8N4O4/c1-13-3-4(8(15)17-2)10-5-6(13)11-9(16)12-7(5)14/h3H,1-2H3,(H,12,14,16) |
| InChIKey | OCTSUUFPRWCDRZ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |