C28H30N10O3 — CID 110171971
1-[4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-1-yl]-4-(4-azidophenyl)butan-1-one (PubChem CID 110171971) has the molecular formula C28H30N10O3 and a molecular weight of 554.62 g/mol. Its IUPAC name is 1-[4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-1-yl]-4-(4-azidophenyl)butan-1-one.
| Compound Name | 1-[4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-1-yl]-4-(4-azidophenyl)butan-1-one |
|---|---|
| PubChem CID | 110171971 |
| Molecular Formula | C28H30N10O3 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 1-[4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-1-yl]-4-(4-azidophenyl)butan-1-one |
| SMILES | COc1ccc(-c2cnc3nc(N)nc(N4CCN(C(=O)CCCc5ccc(N=[N+]=[N-])cc5)CC4)c3n2)cc1OC |
| InChI | InChI=1S/C28H30N10O3/c1-40-22-11-8-19(16-23(22)41-2)21-17-31-26-25(32-21)27(34-28(29)33-26)38-14-12-37(13-15-38)24(39)5-3-4-18-6-9-20(10-7-18)35-36-30/h6-11,16-17H,3-5,12-15H2,1-2H3,(H2,29,31,33,34) |
| InChIKey | FORKFTJKPAEBEW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 168.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|