C23H32N8O2 — CID 69461952
4-[4-(2-aminopentyl)piperazin-1-yl]-6-(3,4-dimethoxyphenyl)pteridin-2-amine (PubChem CID 69461952) has the molecular formula C23H32N8O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 4-[4-(2-aminopentyl)piperazin-1-yl]-6-(3,4-dimethoxyphenyl)pteridin-2-amine.
| Compound Name | 4-[4-(2-aminopentyl)piperazin-1-yl]-6-(3,4-dimethoxyphenyl)pteridin-2-amine |
|---|---|
| PubChem CID | 69461952 |
| Molecular Formula | C23H32N8O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 4-[4-(2-aminopentyl)piperazin-1-yl]-6-(3,4-dimethoxyphenyl)pteridin-2-amine |
| SMILES | CCCC(N)CN1CCN(c2nc(N)nc3ncc(-c4ccc(OC)c(OC)c4)nc23)CC1 |
| InChI | InChI=1S/C23H32N8O2/c1-4-5-16(24)14-30-8-10-31(11-9-30)22-20-21(28-23(25)29-22)26-13-17(27-20)15-6-7-18(32-2)19(12-15)33-3/h6-7,12-13,16H,4-5,8-11,14,24H2,1-3H3,(H2,25,26,28,29) |
| InChIKey | HKEGTOIXNKOLJU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |