C23H31N7O2 — CID 69458973
6-(3,4-dimethoxyphenyl)-4-(4-pentylpiperazin-1-yl)pteridin-2-amine (PubChem CID 69458973) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-(4-pentylpiperazin-1-yl)pteridin-2-amine.
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-(4-pentylpiperazin-1-yl)pteridin-2-amine |
|---|---|
| PubChem CID | 69458973 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-(4-pentylpiperazin-1-yl)pteridin-2-amine |
| SMILES | CCCCCN1CCN(c2nc(N)nc3ncc(-c4ccc(OC)c(OC)c4)nc23)CC1 |
| InChI | InChI=1S/C23H31N7O2/c1-4-5-6-9-29-10-12-30(13-11-29)22-20-21(27-23(24)28-22)25-15-17(26-20)16-7-8-18(31-2)19(14-16)32-3/h7-8,14-15H,4-6,9-13H2,1-3H3,(H2,24,25,27,28) |
| InChIKey | OMGIJCIPLSXJLM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|