C21H25N7O3 — CID 69451906
1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one (PubChem CID 69451906) has the molecular formula C21H25N7O3 and a molecular weight of 423.48 g/mol. Its IUPAC name is 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one.
| Compound Name | 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 69451906 |
| Molecular Formula | C21H25N7O3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one |
| SMILES | CCC(=O)C1CNCCN1c1nc(N)nc2ncc(-c3ccc(OC)c(OC)c3)nc12 |
| InChI | InChI=1S/C21H25N7O3/c1-4-15(29)14-11-23-7-8-28(14)20-18-19(26-21(22)27-20)24-10-13(25-18)12-5-6-16(30-2)17(9-12)31-3/h5-6,9-10,14,23H,4,7-8,11H2,1-3H3,(H2,22,24,26,27) |
| InChIKey | CHNGRBITYQUHQT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |