About 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one
1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one (PubChem CID 69451906) has the molecular formula C21H25N7O3
and a molecular weight of 423.48 g/mol. Its IUPAC name is 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one |
| PubChem CID | 69451906 |
| Molecular Formula | C21H25N7O3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one |
| SMILES | CCC(=O)C1CNCCN1c1nc(N)nc2ncc(-c3ccc(OC)c(OC)c3)nc12 |
| InChI | InChI=1S/C21H25N7O3/c1-4-15(29)14-11-23-7-8-28(14)20-18-19(26-21(22)27-20)24-10-13(25-18)12-5-6-16(30-2)17(9-12)31-3/h5-6,9-10,14,23H,4,7-8,11H2,1-3H3,(H2,22,24,26,27) |
| InChIKey | CHNGRBITYQUHQT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one?
The IUPAC name of 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one (CID 69451906) is 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one.
What is the SMILES notation for 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one?
The canonical SMILES for 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one is CCC(=O)C1CNCCN1c1nc(N)nc2ncc(-c3ccc(OC)c(OC)c3)nc12.
What is the InChIKey of 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one?
The InChIKey is CHNGRBITYQUHQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N7O3/c1-4-15(29)14-11-23-7-8-28(14)20-18-19(26-21(22)27-20)24-10-13(25-18)12-5-6-16(30-2)17(9-12)31-3/h5-6,9-10,14,23H,4,7-8,11H2,1-3H3,(H2,22,24,26,27).
What are the key properties of 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one?
1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one has a molecular weight of 423.48 g/mol, XLogP of 1.44, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]piperazin-2-yl]propan-1-one is sourced from PubChem (CID 69451906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).