C24H23Cl2N7O2 — CID 69452297
4-[2-(3,5-dichlorophenyl)piperazin-1-yl]-6-(3,4-dimethoxyphenyl)pteridin-2-amine (PubChem CID 69452297) has the molecular formula C24H23Cl2N7O2 and a molecular weight of 512.40 g/mol. Its IUPAC name is 4-[2-(3,5-dichlorophenyl)piperazin-1-yl]-6-(3,4-dimethoxyphenyl)pteridin-2-amine.
| Compound Name | 4-[2-(3,5-dichlorophenyl)piperazin-1-yl]-6-(3,4-dimethoxyphenyl)pteridin-2-amine |
|---|---|
| PubChem CID | 69452297 |
| Molecular Formula | C24H23Cl2N7O2 |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 4-[2-(3,5-dichlorophenyl)piperazin-1-yl]-6-(3,4-dimethoxyphenyl)pteridin-2-amine |
| SMILES | COc1ccc(-c2cnc3nc(N)nc(N4CCNCC4c4cc(Cl)cc(Cl)c4)c3n2)cc1OC |
| InChI | InChI=1S/C24H23Cl2N7O2/c1-34-19-4-3-13(9-20(19)35-2)17-11-29-22-21(30-17)23(32-24(27)31-22)33-6-5-28-12-18(33)14-7-15(25)10-16(26)8-14/h3-4,7-11,18,28H,5-6,12H2,1-2H3,(H2,27,29,31,32) |
| InChIKey | GIXQVXRUUYRZPL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |