C23H29N7O2 — CID 11453334
4-(4-cyclopentylpiperazin-1-yl)-6-(3,4-dimethoxyphenyl)pteridin-2-amine (PubChem CID 11453334) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 4-(4-cyclopentylpiperazin-1-yl)-6-(3,4-dimethoxyphenyl)pteridin-2-amine.
| Compound Name | 4-(4-cyclopentylpiperazin-1-yl)-6-(3,4-dimethoxyphenyl)pteridin-2-amine |
|---|---|
| PubChem CID | 11453334 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 4-(4-cyclopentylpiperazin-1-yl)-6-(3,4-dimethoxyphenyl)pteridin-2-amine |
| SMILES | COc1ccc(-c2cnc3nc(N)nc(N4CCN(C5CCCC5)CC4)c3n2)cc1OC |
| InChI | InChI=1S/C23H29N7O2/c1-31-18-8-7-15(13-19(18)32-2)17-14-25-21-20(26-17)22(28-23(24)27-21)30-11-9-29(10-12-30)16-5-3-4-6-16/h7-8,13-14,16H,3-6,9-12H2,1-2H3,(H2,24,25,27,28) |
| InChIKey | MGNZHEJSZOLZRX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |