C18H22N6O2 — CID 11164068
4-N-[(2S)-butan-2-yl]-6-(3,4-dimethoxyphenyl)pteridine-2,4-diamine (PubChem CID 11164068) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-N-[(2S)-butan-2-yl]-6-(3,4-dimethoxyphenyl)pteridine-2,4-diamine.
| Compound Name | 4-N-[(2S)-butan-2-yl]-6-(3,4-dimethoxyphenyl)pteridine-2,4-diamine |
|---|---|
| PubChem CID | 11164068 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-N-[(2S)-butan-2-yl]-6-(3,4-dimethoxyphenyl)pteridine-2,4-diamine |
| SMILES | CC[C@H](C)Nc1nc(N)nc2ncc(-c3ccc(OC)c(OC)c3)nc12 |
| InChI | InChI=1S/C18H22N6O2/c1-5-10(2)21-17-15-16(23-18(19)24-17)20-9-12(22-15)11-6-7-13(25-3)14(8-11)26-4/h6-10H,5H2,1-4H3,(H3,19,20,21,23,24)/t10-/m0/s1 |
| InChIKey | RNVZMGKIYZXWBL-JTQLQIEISA-N |
| XLogP | 2.90 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |