C30H51NO7Si — CID 11017211
(2S)-7-[(4S,5S)-2,2-dimethyl-5-[tri(propan-2-yl)silyloxymethyl]-1,3-dioxolan-4-yl]-2-(phenylmethoxycarbonylamino)heptanoic acid (PubChem CID 11017211) has the molecular formula C30H51NO7Si and a molecular weight of 565.82 g/mol. Its IUPAC name is (2S)-7-[(4S,5S)-2,2-dimethyl-5-[tri(propan-2-yl)silyloxymethyl]-1,3-dioxolan-4-yl]-2-(phenylmethoxycarbonylamino)heptanoic acid.
| Compound Name | (2S)-7-[(4S,5S)-2,2-dimethyl-5-[tri(propan-2-yl)silyloxymethyl]-1,3-dioxolan-4-yl]-2-(phenylmethoxycarbonylamino)heptanoic acid |
|---|---|
| PubChem CID | 11017211 |
| Molecular Formula | C30H51NO7Si |
| Molecular Weight | 565.82 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | (2S)-7-[(4S,5S)-2,2-dimethyl-5-[tri(propan-2-yl)silyloxymethyl]-1,3-dioxolan-4-yl]-2-(phenylmethoxycarbonylamino)heptanoic acid |
| SMILES | CC(C)[Si](OC[C@@H]1OC(C)(C)O[C@H]1CCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H51NO7Si/c1-21(2)39(22(3)4,23(5)6)36-20-27-26(37-30(7,8)38-27)18-14-10-13-17-25(28(32)33)31-29(34)35-19-24-15-11-9-12-16-24/h9,11-12,15-16,21-23,25-27H,10,13-14,17-20H2,1-8H3,(H,31,34)(H,32,33)/t25-,26-,27-/m0/s1 |
| InChIKey | CAEBALZJEWKJRO-QKDODKLFSA-N |
| XLogP | 7.03 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.82 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|