C18H20N2S2 — CID 110172551
3-butyl-2,5-dimethyl-6-phenylthieno[2,3-d]pyrimidine-4-thione (PubChem CID 110172551) has the molecular formula C18H20N2S2 and a molecular weight of 328.51 g/mol. Its IUPAC name is 3-butyl-2,5-dimethyl-6-phenylthieno[2,3-d]pyrimidine-4-thione.
| Compound Name | 3-butyl-2,5-dimethyl-6-phenylthieno[2,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 110172551 |
| Molecular Formula | C18H20N2S2 |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-butyl-2,5-dimethyl-6-phenylthieno[2,3-d]pyrimidine-4-thione |
| SMILES | CCCCn1c(C)nc2sc(-c3ccccc3)c(C)c2c1=S |
| InChI | InChI=1S/C18H20N2S2/c1-4-5-11-20-13(3)19-17-15(18(20)21)12(2)16(22-17)14-9-7-6-8-10-14/h6-10H,4-5,11H2,1-3H3 |
| InChIKey | DECSPDWKDUDAID-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|