C33H44O2P+ — CID 11017336
[(9S,10S)-9-(methoxymethoxy)-10-methyldodec-11-enyl]-triphenylphosphanium (PubChem CID 11017336) has the molecular formula C33H44O2P+ and a molecular weight of 503.69 g/mol. Its IUPAC name is [(9S,10S)-9-(methoxymethoxy)-10-methyldodec-11-enyl]-triphenylphosphanium.
| Compound Name | [(9S,10S)-9-(methoxymethoxy)-10-methyldodec-11-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 11017336 |
| Molecular Formula | C33H44O2P+ |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | [(9S,10S)-9-(methoxymethoxy)-10-methyldodec-11-enyl]-triphenylphosphanium |
| SMILES | C=C[C@H](C)[C@H](CCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)OCOC |
| InChI | InChI=1S/C33H44O2P/c1-4-29(2)33(35-28-34-3)26-18-7-5-6-8-19-27-36(30-20-12-9-13-21-30,31-22-14-10-15-23-31)32-24-16-11-17-25-32/h4,9-17,20-25,29,33H,1,5-8,18-19,26-28H2,2-3H3/q+1/t29-,33-/m0/s1 |
| InChIKey | AQMFMEZQGHZZGU-ZQAZVOLISA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|