C16H14N2OS — CID 110179797
3-methyl-1-pyrido[3,2-b][1,4]benzothiazin-10-ylbut-2-en-1-one (PubChem CID 110179797) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-methyl-1-pyrido[3,2-b][1,4]benzothiazin-10-ylbut-2-en-1-one.
| Compound Name | 3-methyl-1-pyrido[3,2-b][1,4]benzothiazin-10-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 110179797 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-methyl-1-pyrido[3,2-b][1,4]benzothiazin-10-ylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1c2ccccc2Sc2cccnc21 |
| InChI | InChI=1S/C16H14N2OS/c1-11(2)10-15(19)18-12-6-3-4-7-13(12)20-14-8-5-9-17-16(14)18/h3-10H,1-2H3 |
| InChIKey | SYTUTXSMQVSJRK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|