C14H21ClN2O3 — CID 110180850
5-chloro-2,3-dihydro-1,3-benzoxazole-2-carboxylate;triethylazanium (PubChem CID 110180850) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1,3-benzoxazole-2-carboxylate;triethylazanium.
| Compound Name | 5-chloro-2,3-dihydro-1,3-benzoxazole-2-carboxylate;triethylazanium |
|---|---|
| PubChem CID | 110180850 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 5-chloro-2,3-dihydro-1,3-benzoxazole-2-carboxylate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=C([O-])C1Nc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C8H6ClNO3.C6H15N/c9-4-1-2-6-5(3-4)10-7(13-6)8(11)12;1-4-7(5-2)6-3/h1-3,7,10H,(H,11,12);4-6H2,1-3H3 |
| InChIKey | WCJMYZGRZYVBRE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 65.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |