C26H27NO5S2 — CID 110182413
4-[3,3-di(thiophen-3-yl)prop-2-enyl]-3-methyl-2-phenylmorpholin-4-ium;(E)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 110182413) has the molecular formula C26H27NO5S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 4-[3,3-di(thiophen-3-yl)prop-2-enyl]-3-methyl-2-phenylmorpholin-4-ium;(E)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | 4-[3,3-di(thiophen-3-yl)prop-2-enyl]-3-methyl-2-phenylmorpholin-4-ium;(E)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 110182413 |
| Molecular Formula | C26H27NO5S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 4-[3,3-di(thiophen-3-yl)prop-2-enyl]-3-methyl-2-phenylmorpholin-4-ium;(E)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | CC1C(c2ccccc2)OCC[NH+]1CC=C(c1ccsc1)c1ccsc1.O=C([O-])/C=C/C(=O)O |
| InChI | InChI=1S/C22H23NOS2.C4H4O4/c1-17-22(18-5-3-2-4-6-18)24-12-11-23(17)10-7-21(19-8-13-25-15-19)20-9-14-26-16-20;5-3(6)1-2-4(7)8/h2-9,13-17,22H,10-12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | OYAOSAQYSOOBHS-WLHGVMLRSA-N |
| XLogP | 2.66 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|