C19H32Cl2N2O — CID 110183993
1-(2-cyclohexylethyl)-4-(2-methoxyphenyl)piperazine-1,4-diium dichloride (PubChem CID 110183993) has the molecular formula C19H32Cl2N2O and a molecular weight of 375.38 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-4-(2-methoxyphenyl)piperazine-1,4-diium dichloride.
| Compound Name | 1-(2-cyclohexylethyl)-4-(2-methoxyphenyl)piperazine-1,4-diium dichloride |
|---|---|
| PubChem CID | 110183993 |
| Molecular Formula | C19H32Cl2N2O |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1-(2-cyclohexylethyl)-4-(2-methoxyphenyl)piperazine-1,4-diium dichloride |
| SMILES | COc1ccccc1[NH+]1CC[NH+](CCC2CCCCC2)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C19H30N2O.2ClH/c1-22-19-10-6-5-9-18(19)21-15-13-20(14-16-21)12-11-17-7-3-2-4-8-17;;/h5-6,9-10,17H,2-4,7-8,11-16H2,1H3;2*1H |
| InChIKey | TVVUOGGAMGKYNW-UHFFFAOYSA-N |
| XLogP | -4.91 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |