C9H13N5S2 — CID 110189308
[4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate (PubChem CID 110189308) has the molecular formula C9H13N5S2 and a molecular weight of 255.37 g/mol. Its IUPAC name is [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate.
| Compound Name | [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate |
|---|---|
| PubChem CID | 110189308 |
| Molecular Formula | C9H13N5S2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate |
| SMILES | CSc1nc(NC(C)(C)C)nc(SC#N)n1 |
| InChI | InChI=1S/C9H13N5S2/c1-9(2,3)14-6-11-7(15-4)13-8(12-6)16-5-10/h1-4H3,(H,11,12,13,14) |
| InChIKey | IYKLOULRJWAKOS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|