About [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate
[4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate (PubChem CID 110189308) has the molecular formula C9H13N5S2
and a molecular weight of 255.37 g/mol. Its IUPAC name is [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate.
Molecular Properties
| Compound Name | [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate |
| PubChem CID | 110189308 |
| Molecular Formula | C9H13N5S2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate |
| SMILES | CSc1nc(NC(C)(C)C)nc(SC#N)n1 |
| InChI | InChI=1S/C9H13N5S2/c1-9(2,3)14-6-11-7(15-4)13-8(12-6)16-5-10/h1-4H3,(H,11,12,13,14) |
| InChIKey | IYKLOULRJWAKOS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate?
The IUPAC name of [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate (CID 110189308) is [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate.
What is the SMILES notation for [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate?
The canonical SMILES for [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate is CSc1nc(NC(C)(C)C)nc(SC#N)n1.
What is the InChIKey of [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate?
The InChIKey is IYKLOULRJWAKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5S2/c1-9(2,3)14-6-11-7(15-4)13-8(12-6)16-5-10/h1-4H3,(H,11,12,13,14).
What are the key properties of [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate?
[4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate has a molecular weight of 255.37 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(tert-butylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl] thiocyanate is sourced from PubChem (CID 110189308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).