C11H16N6S — CID 110189313
[4-(diethylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl] thiocyanate (PubChem CID 110189313) has the molecular formula C11H16N6S and a molecular weight of 264.36 g/mol. Its IUPAC name is [4-(diethylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl] thiocyanate.
| Compound Name | [4-(diethylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl] thiocyanate |
|---|---|
| PubChem CID | 110189313 |
| Molecular Formula | C11H16N6S |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [4-(diethylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl] thiocyanate |
| SMILES | C=CCNc1nc(SC#N)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C11H16N6S/c1-4-7-13-9-14-10(17(5-2)6-3)16-11(15-9)18-8-12/h4H,1,5-7H2,2-3H3,(H,13,14,15,16) |
| InChIKey | NFUJVBVGPBGHEF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|